C24H41N3O4 — CID 70420737
1,2-diacetyl-4-octadec-9-enyl-1,2,4-triazolidine-3,5-dione (PubChem CID 70420737) has the molecular formula C24H41N3O4 and a molecular weight of 435.61 g/mol. Its IUPAC name is 1,2-diacetyl-4-octadec-9-enyl-1,2,4-triazolidine-3,5-dione.
| Compound Name | 1,2-diacetyl-4-octadec-9-enyl-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 70420737 |
| Molecular Formula | C24H41N3O4 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.31 |
| IUPAC Name | 1,2-diacetyl-4-octadec-9-enyl-1,2,4-triazolidine-3,5-dione |
| SMILES | CCCCCCCCC=CCCCCCCCCn1c(=O)n(C(C)=O)n(C(C)=O)c1=O |
| InChI | InChI=1S/C24H41N3O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25-23(30)26(21(2)28)27(22(3)29)24(25)31/h11-12H,4-10,13-20H2,1-3H3 |
| InChIKey | ZDLNXTYKSMGEGS-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|