About 4-amino-3,5-diaminooxyphenol
4-amino-3,5-diaminooxyphenol (PubChem CID 70420776) has the molecular formula C6H9N3O3
and a molecular weight of 171.16 g/mol. Its IUPAC name is 4-amino-3,5-diaminooxyphenol.
Molecular Properties
| Compound Name | 4-amino-3,5-diaminooxyphenol |
| PubChem CID | 70420776 |
| Molecular Formula | C6H9N3O3 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | 4-amino-3,5-diaminooxyphenol |
| SMILES | NOc1cc(O)cc(ON)c1N |
| InChI | InChI=1S/C6H9N3O3/c7-6-4(11-8)1-3(10)2-5(6)12-9/h1-2,10H,7-9H2 |
| InChIKey | YWOZRBHNVJTTOR-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3,5-diaminooxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3,5-diaminooxyphenol?
The IUPAC name of 4-amino-3,5-diaminooxyphenol (CID 70420776) is 4-amino-3,5-diaminooxyphenol.
What is the SMILES notation for 4-amino-3,5-diaminooxyphenol?
The canonical SMILES for 4-amino-3,5-diaminooxyphenol is NOc1cc(O)cc(ON)c1N.
What is the InChIKey of 4-amino-3,5-diaminooxyphenol?
The InChIKey is YWOZRBHNVJTTOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O3/c7-6-4(11-8)1-3(10)2-5(6)12-9/h1-2,10H,7-9H2.
What are the key properties of 4-amino-3,5-diaminooxyphenol?
4-amino-3,5-diaminooxyphenol has a molecular weight of 171.16 g/mol, XLogP of -0.52, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3,5-diaminooxyphenol is sourced from PubChem (CID 70420776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).