C19H29N — CID 70420842
1,2,2,3,3-pentakis(prop-2-enyl)pyrrolidine (PubChem CID 70420842) has the molecular formula C19H29N and a molecular weight of 271.45 g/mol. Its IUPAC name is 1,2,2,3,3-pentakis(prop-2-enyl)pyrrolidine.
| Compound Name | 1,2,2,3,3-pentakis(prop-2-enyl)pyrrolidine |
|---|---|
| PubChem CID | 70420842 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | 1,2,2,3,3-pentakis(prop-2-enyl)pyrrolidine |
| SMILES | C=CCN1CCC(CC=C)(CC=C)C1(CC=C)CC=C |
| InChI | InChI=1S/C19H29N/c1-6-11-18(12-7-2)15-17-20(16-10-5)19(18,13-8-3)14-9-4/h6-10H,1-5,11-17H2 |
| InChIKey | NRTKYUYELLWXFS-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|