C15H19N3O3 — CID 70421145
[1-[2-(4-cyanophenoxy)ethyl]piperidin-3-yl] carbamate (PubChem CID 70421145) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is [1-[2-(4-cyanophenoxy)ethyl]piperidin-3-yl] carbamate.
| Compound Name | [1-[2-(4-cyanophenoxy)ethyl]piperidin-3-yl] carbamate |
|---|---|
| PubChem CID | 70421145 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | [1-[2-(4-cyanophenoxy)ethyl]piperidin-3-yl] carbamate |
| SMILES | N#Cc1ccc(OCCN2CCCC(OC(N)=O)C2)cc1 |
| InChI | InChI=1S/C15H19N3O3/c16-10-12-3-5-13(6-4-12)20-9-8-18-7-1-2-14(11-18)21-15(17)19/h3-6,14H,1-2,7-9,11H2,(H2,17,19) |
| InChIKey | VMPCFWYKMLTPSU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 88.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |