About 1-butyl-7-[(2-methyl-1,3-dioxolan-2-yl)methyl]-3H-purine-2,6-dione
1-butyl-7-[(2-methyl-1,3-dioxolan-2-yl)methyl]-3H-purine-2,6-dione (PubChem CID 70421254) has the molecular formula C14H20N4O4
and a molecular weight of 308.34 g/mol. Its IUPAC name is 1-butyl-7-[(2-methyl-1,3-dioxolan-2-yl)methyl]-3H-purine-2,6-dione.
Molecular Properties
| Compound Name | 1-butyl-7-[(2-methyl-1,3-dioxolan-2-yl)methyl]-3H-purine-2,6-dione |
| PubChem CID | 70421254 |
| Molecular Formula | C14H20N4O4 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 1-butyl-7-[(2-methyl-1,3-dioxolan-2-yl)methyl]-3H-purine-2,6-dione |
| SMILES | CCCCn1c(=O)[nH]c2ncn(CC3(C)OCCO3)c2c1=O |
| InChI | InChI=1S/C14H20N4O4/c1-3-4-5-18-12(19)10-11(16-13(18)20)15-9-17(10)8-14(2)21-6-7-22-14/h9H,3-8H2,1-2H3,(H,16,20) |
| InChIKey | CHPFQDRYIJPMFM-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-butyl-7-[(2-methyl-1,3-dioxolan-2-yl)methyl]-3H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-7-[(2-methyl-1,3-dioxolan-2-yl)methyl]-3H-purine-2,6-dione?
The IUPAC name of 1-butyl-7-[(2-methyl-1,3-dioxolan-2-yl)methyl]-3H-purine-2,6-dione (CID 70421254) is 1-butyl-7-[(2-methyl-1,3-dioxolan-2-yl)methyl]-3H-purine-2,6-dione.
What is the SMILES notation for 1-butyl-7-[(2-methyl-1,3-dioxolan-2-yl)methyl]-3H-purine-2,6-dione?
The canonical SMILES for 1-butyl-7-[(2-methyl-1,3-dioxolan-2-yl)methyl]-3H-purine-2,6-dione is CCCCn1c(=O)[nH]c2ncn(CC3(C)OCCO3)c2c1=O.
What is the InChIKey of 1-butyl-7-[(2-methyl-1,3-dioxolan-2-yl)methyl]-3H-purine-2,6-dione?
The InChIKey is CHPFQDRYIJPMFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4O4/c1-3-4-5-18-12(19)10-11(16-13(18)20)15-9-17(10)8-14(2)21-6-7-22-14/h9H,3-8H2,1-2H3,(H,16,20).
What are the key properties of 1-butyl-7-[(2-methyl-1,3-dioxolan-2-yl)methyl]-3H-purine-2,6-dione?
1-butyl-7-[(2-methyl-1,3-dioxolan-2-yl)methyl]-3H-purine-2,6-dione has a molecular weight of 308.34 g/mol, XLogP of 0.45, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-7-[(2-methyl-1,3-dioxolan-2-yl)methyl]-3H-purine-2,6-dione is sourced from PubChem (CID 70421254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).