About 4-[1-[4-amino-3,5-di(propan-2-yl)phenyl]propyl]-2,6-di(propan-2-yl)aniline
4-[1-[4-amino-3,5-di(propan-2-yl)phenyl]propyl]-2,6-di(propan-2-yl)aniline (PubChem CID 70421287) has the molecular formula C27H42N2
and a molecular weight of 394.65 g/mol. Its IUPAC name is 4-[1-[4-amino-3,5-di(propan-2-yl)phenyl]propyl]-2,6-di(propan-2-yl)aniline.
Molecular Properties
| Compound Name | 4-[1-[4-amino-3,5-di(propan-2-yl)phenyl]propyl]-2,6-di(propan-2-yl)aniline |
| PubChem CID | 70421287 |
| Molecular Formula | C27H42N2 |
| Molecular Weight | 394.65 g/mol |
| Exact Mass | 394.33 |
| IUPAC Name | 4-[1-[4-amino-3,5-di(propan-2-yl)phenyl]propyl]-2,6-di(propan-2-yl)aniline |
| SMILES | CCC(c1cc(C(C)C)c(N)c(C(C)C)c1)c1cc(C(C)C)c(N)c(C(C)C)c1 |
| InChI | InChI=1S/C27H42N2/c1-10-21(19-11-22(15(2)3)26(28)23(12-19)16(4)5)20-13-24(17(6)7)27(29)25(14-20)18(8)9/h11-18,21H,10,28-29H2,1-9H3 |
| InChIKey | AHULZUFAXCILGD-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.65 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-[4-amino-3,5-di(propan-2-yl)phenyl]propyl]-2,6-di(propan-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[4-amino-3,5-di(propan-2-yl)phenyl]propyl]-2,6-di(propan-2-yl)aniline?
The IUPAC name of 4-[1-[4-amino-3,5-di(propan-2-yl)phenyl]propyl]-2,6-di(propan-2-yl)aniline (CID 70421287) is 4-[1-[4-amino-3,5-di(propan-2-yl)phenyl]propyl]-2,6-di(propan-2-yl)aniline.
What is the SMILES notation for 4-[1-[4-amino-3,5-di(propan-2-yl)phenyl]propyl]-2,6-di(propan-2-yl)aniline?
The canonical SMILES for 4-[1-[4-amino-3,5-di(propan-2-yl)phenyl]propyl]-2,6-di(propan-2-yl)aniline is CCC(c1cc(C(C)C)c(N)c(C(C)C)c1)c1cc(C(C)C)c(N)c(C(C)C)c1.
What is the InChIKey of 4-[1-[4-amino-3,5-di(propan-2-yl)phenyl]propyl]-2,6-di(propan-2-yl)aniline?
The InChIKey is AHULZUFAXCILGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H42N2/c1-10-21(19-11-22(15(2)3)26(28)23(12-19)16(4)5)20-13-24(17(6)7)27(29)25(14-20)18(8)9/h11-18,21H,10,28-29H2,1-9H3.
What are the key properties of 4-[1-[4-amino-3,5-di(propan-2-yl)phenyl]propyl]-2,6-di(propan-2-yl)aniline?
4-[1-[4-amino-3,5-di(propan-2-yl)phenyl]propyl]-2,6-di(propan-2-yl)aniline has a molecular weight of 394.65 g/mol, XLogP of 7.89, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[4-amino-3,5-di(propan-2-yl)phenyl]propyl]-2,6-di(propan-2-yl)aniline is sourced from PubChem (CID 70421287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).