About 5,6-diamino-1-ethyl-3,3-dimethylindol-2-one;dihydrochloride
5,6-diamino-1-ethyl-3,3-dimethylindol-2-one;dihydrochloride (PubChem CID 70421420) has the molecular formula C12H19Cl2N3O
and a molecular weight of 292.21 g/mol. Its IUPAC name is 5,6-diamino-1-ethyl-3,3-dimethylindol-2-one;dihydrochloride.
Molecular Properties
| Compound Name | 5,6-diamino-1-ethyl-3,3-dimethylindol-2-one;dihydrochloride |
| PubChem CID | 70421420 |
| Molecular Formula | C12H19Cl2N3O |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 5,6-diamino-1-ethyl-3,3-dimethylindol-2-one;dihydrochloride |
| SMILES | CCN1C(=O)C(C)(C)c2cc(N)c(N)cc21.Cl.Cl |
| InChI | InChI=1S/C12H17N3O.2ClH/c1-4-15-10-6-9(14)8(13)5-7(10)12(2,3)11(15)16;;/h5-6H,4,13-14H2,1-3H3;2*1H |
| InChIKey | CDBTVKDGZGEGEY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5,6-diamino-1-ethyl-3,3-dimethylindol-2-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-diamino-1-ethyl-3,3-dimethylindol-2-one;dihydrochloride?
The IUPAC name of 5,6-diamino-1-ethyl-3,3-dimethylindol-2-one;dihydrochloride (CID 70421420) is 5,6-diamino-1-ethyl-3,3-dimethylindol-2-one;dihydrochloride.
What is the SMILES notation for 5,6-diamino-1-ethyl-3,3-dimethylindol-2-one;dihydrochloride?
The canonical SMILES for 5,6-diamino-1-ethyl-3,3-dimethylindol-2-one;dihydrochloride is CCN1C(=O)C(C)(C)c2cc(N)c(N)cc21.Cl.Cl.
What is the InChIKey of 5,6-diamino-1-ethyl-3,3-dimethylindol-2-one;dihydrochloride?
The InChIKey is CDBTVKDGZGEGEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O.2ClH/c1-4-15-10-6-9(14)8(13)5-7(10)12(2,3)11(15)16;;/h5-6H,4,13-14H2,1-3H3;2*1H.
What are the key properties of 5,6-diamino-1-ethyl-3,3-dimethylindol-2-one;dihydrochloride?
5,6-diamino-1-ethyl-3,3-dimethylindol-2-one;dihydrochloride has a molecular weight of 292.21 g/mol, XLogP of 2.34, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-diamino-1-ethyl-3,3-dimethylindol-2-one;dihydrochloride is sourced from PubChem (CID 70421420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).