C23H40O3Si — CID 70421684
[(3aR,7aR)-5-ethenyl-2-(oxan-2-yloxy)-2,3,3a,6,7,7a-hexahydro-1H-inden-1-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 70421684) has the molecular formula C23H40O3Si and a molecular weight of 392.66 g/mol. Its IUPAC name is [(3aR,7aR)-5-ethenyl-2-(oxan-2-yloxy)-2,3,3a,6,7,7a-hexahydro-1H-inden-1-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,7aR)-5-ethenyl-2-(oxan-2-yloxy)-2,3,3a,6,7,7a-hexahydro-1H-inden-1-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 70421684 |
| Molecular Formula | C23H40O3Si |
| Molecular Weight | 392.66 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | [(3aR,7aR)-5-ethenyl-2-(oxan-2-yloxy)-2,3,3a,6,7,7a-hexahydro-1H-inden-1-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C=CC1=C[C@@H]2CC(OC3CCCCO3)C(CO[Si](C)(C)C(C)(C)C)[C@@H]2CC1 |
| InChI | InChI=1S/C23H40O3Si/c1-7-17-11-12-19-18(14-17)15-21(26-22-10-8-9-13-24-22)20(19)16-25-27(5,6)23(2,3)4/h7,14,18-22H,1,8-13,15-16H2,2-6H3/t18-,19-,20?,21?,22?/m1/s1 |
| InChIKey | OURLCDXWLWTKKF-ZZDYOGERSA-N |
| XLogP | 6.08 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.66 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|