About 3-(methoxymethyl)-7-azabicyclo[4.1.0]hepta-1(6),2,4-triene;4-methylpyrimidine
3-(methoxymethyl)-7-azabicyclo[4.1.0]hepta-1(6),2,4-triene;4-methylpyrimidine (PubChem CID 70421799) has the molecular formula C13H15N3O
and a molecular weight of 229.28 g/mol. Its IUPAC name is 3-(methoxymethyl)-7-azabicyclo[4.1.0]hepta-1(6),2,4-triene;4-methylpyrimidine.
Molecular Properties
| Compound Name | 3-(methoxymethyl)-7-azabicyclo[4.1.0]hepta-1(6),2,4-triene;4-methylpyrimidine |
| PubChem CID | 70421799 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 3-(methoxymethyl)-7-azabicyclo[4.1.0]hepta-1(6),2,4-triene;4-methylpyrimidine |
| SMILES | COCc1ccc2c(c1)N2.Cc1ccncn1 |
| InChI | InChI=1S/C8H9NO.C5H6N2/c1-10-5-6-2-3-7-8(4-6)9-7;1-5-2-3-6-4-7-5/h2-4,9H,5H2,1H3;2-4H,1H3 |
| InChIKey | VNAYPOMQLOTEKI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-(methoxymethyl)-7-azabicyclo[4.1.0]hepta-1(6),2,4-triene;4-methylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methoxymethyl)-7-azabicyclo[4.1.0]hepta-1(6),2,4-triene;4-methylpyrimidine?
The IUPAC name of 3-(methoxymethyl)-7-azabicyclo[4.1.0]hepta-1(6),2,4-triene;4-methylpyrimidine (CID 70421799) is 3-(methoxymethyl)-7-azabicyclo[4.1.0]hepta-1(6),2,4-triene;4-methylpyrimidine.
What is the SMILES notation for 3-(methoxymethyl)-7-azabicyclo[4.1.0]hepta-1(6),2,4-triene;4-methylpyrimidine?
The canonical SMILES for 3-(methoxymethyl)-7-azabicyclo[4.1.0]hepta-1(6),2,4-triene;4-methylpyrimidine is COCc1ccc2c(c1)N2.Cc1ccncn1.
What is the InChIKey of 3-(methoxymethyl)-7-azabicyclo[4.1.0]hepta-1(6),2,4-triene;4-methylpyrimidine?
The InChIKey is VNAYPOMQLOTEKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO.C5H6N2/c1-10-5-6-2-3-7-8(4-6)9-7;1-5-2-3-6-4-7-5/h2-4,9H,5H2,1H3;2-4H,1H3.
What are the key properties of 3-(methoxymethyl)-7-azabicyclo[4.1.0]hepta-1(6),2,4-triene;4-methylpyrimidine?
3-(methoxymethyl)-7-azabicyclo[4.1.0]hepta-1(6),2,4-triene;4-methylpyrimidine has a molecular weight of 229.28 g/mol, XLogP of 2.68, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methoxymethyl)-7-azabicyclo[4.1.0]hepta-1(6),2,4-triene;4-methylpyrimidine is sourced from PubChem (CID 70421799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).