C19H22N4O — CID 70421947
2-(4-aminophenyl)-5-ethyl-7,7-dimethyl-2,3-dihydro-1H-pyrrolo[2,3-f]benzimidazol-6-one (PubChem CID 70421947) has the molecular formula C19H22N4O and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-(4-aminophenyl)-5-ethyl-7,7-dimethyl-2,3-dihydro-1H-pyrrolo[2,3-f]benzimidazol-6-one.
| Compound Name | 2-(4-aminophenyl)-5-ethyl-7,7-dimethyl-2,3-dihydro-1H-pyrrolo[2,3-f]benzimidazol-6-one |
|---|---|
| PubChem CID | 70421947 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 2-(4-aminophenyl)-5-ethyl-7,7-dimethyl-2,3-dihydro-1H-pyrrolo[2,3-f]benzimidazol-6-one |
| SMILES | CCN1C(=O)C(C)(C)c2cc3c(cc21)NC(c1ccc(N)cc1)N3 |
| InChI | InChI=1S/C19H22N4O/c1-4-23-16-10-15-14(9-13(16)19(2,3)18(23)24)21-17(22-15)11-5-7-12(20)8-6-11/h5-10,17,21-22H,4,20H2,1-3H3 |
| InChIKey | GJNGJAYWPUSDJJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|