C20H28N4O — CID 70422464
[(6aR)-4-pentyl-6a,7,8,9,10,10a-hexahydro-6H-indolo[4,3-fg]quinolin-5-yl]urea (PubChem CID 70422464) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is [(6aR)-4-pentyl-6a,7,8,9,10,10a-hexahydro-6H-indolo[4,3-fg]quinolin-5-yl]urea.
| Compound Name | [(6aR)-4-pentyl-6a,7,8,9,10,10a-hexahydro-6H-indolo[4,3-fg]quinolin-5-yl]urea |
|---|---|
| PubChem CID | 70422464 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | [(6aR)-4-pentyl-6a,7,8,9,10,10a-hexahydro-6H-indolo[4,3-fg]quinolin-5-yl]urea |
| SMILES | CCCCCn1c(NC(N)=O)c2c3c(cccc31)C1CCCN[C@@H]1C2 |
| InChI | InChI=1S/C20H28N4O/c1-2-3-4-11-24-17-9-5-7-14-13-8-6-10-22-16(13)12-15(18(14)17)19(24)23-20(21)25/h5,7,9,13,16,22H,2-4,6,8,10-12H2,1H3,(H3,21,23,25)/t13?,16-/m1/s1 |
| InChIKey | AURGJOQOHMMPNB-FQNRMIAFSA-N |
| XLogP | 3.71 |
| TPSA | 72.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|