C15H11F3NO4S- — CID 7042249
2-[4-[[3-(trifluoromethyl)phenyl]sulfonylamino]phenyl]acetate (PubChem CID 7042249) has the molecular formula C15H11F3NO4S- and a molecular weight of 358.32 g/mol. Its IUPAC name is 2-[4-[[3-(trifluoromethyl)phenyl]sulfonylamino]phenyl]acetate.
| Compound Name | 2-[4-[[3-(trifluoromethyl)phenyl]sulfonylamino]phenyl]acetate |
|---|---|
| PubChem CID | 7042249 |
| Molecular Formula | C15H11F3NO4S- |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 2-[4-[[3-(trifluoromethyl)phenyl]sulfonylamino]phenyl]acetate |
| SMILES | O=C([O-])Cc1ccc(NS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C15H12F3NO4S/c16-15(17,18)11-2-1-3-13(9-11)24(22,23)19-12-6-4-10(5-7-12)8-14(20)21/h1-7,9,19H,8H2,(H,20,21)/p-1 |
| InChIKey | SQNFRPZHMDOZMJ-UHFFFAOYSA-M |
| XLogP | 1.80 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |