About 5-ethyl-7,7-dimethyl-2-pyridin-2-yl-1H-pyrrolo[2,3-f]benzimidazol-6-one
5-ethyl-7,7-dimethyl-2-pyridin-2-yl-1H-pyrrolo[2,3-f]benzimidazol-6-one (PubChem CID 70422686) has the molecular formula C18H18N4O
and a molecular weight of 306.37 g/mol. Its IUPAC name is 5-ethyl-7,7-dimethyl-2-pyridin-2-yl-1H-pyrrolo[2,3-f]benzimidazol-6-one.
Molecular Properties
| Compound Name | 5-ethyl-7,7-dimethyl-2-pyridin-2-yl-1H-pyrrolo[2,3-f]benzimidazol-6-one |
| PubChem CID | 70422686 |
| Molecular Formula | C18H18N4O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 5-ethyl-7,7-dimethyl-2-pyridin-2-yl-1H-pyrrolo[2,3-f]benzimidazol-6-one |
| SMILES | CCN1C(=O)C(C)(C)c2cc3[nH]c(-c4ccccn4)nc3cc21 |
| InChI | InChI=1S/C18H18N4O/c1-4-22-15-10-14-13(9-11(15)18(2,3)17(22)23)20-16(21-14)12-7-5-6-8-19-12/h5-10H,4H2,1-3H3,(H,20,21) |
| InChIKey | OTSUUIYCNKJRBK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethyl-7,7-dimethyl-2-pyridin-2-yl-1H-pyrrolo[2,3-f]benzimidazol-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-7,7-dimethyl-2-pyridin-2-yl-1H-pyrrolo[2,3-f]benzimidazol-6-one?
The IUPAC name of 5-ethyl-7,7-dimethyl-2-pyridin-2-yl-1H-pyrrolo[2,3-f]benzimidazol-6-one (CID 70422686) is 5-ethyl-7,7-dimethyl-2-pyridin-2-yl-1H-pyrrolo[2,3-f]benzimidazol-6-one.
What is the SMILES notation for 5-ethyl-7,7-dimethyl-2-pyridin-2-yl-1H-pyrrolo[2,3-f]benzimidazol-6-one?
The canonical SMILES for 5-ethyl-7,7-dimethyl-2-pyridin-2-yl-1H-pyrrolo[2,3-f]benzimidazol-6-one is CCN1C(=O)C(C)(C)c2cc3[nH]c(-c4ccccn4)nc3cc21.
What is the InChIKey of 5-ethyl-7,7-dimethyl-2-pyridin-2-yl-1H-pyrrolo[2,3-f]benzimidazol-6-one?
The InChIKey is OTSUUIYCNKJRBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4O/c1-4-22-15-10-14-13(9-11(15)18(2,3)17(22)23)20-16(21-14)12-7-5-6-8-19-12/h5-10H,4H2,1-3H3,(H,20,21).
What are the key properties of 5-ethyl-7,7-dimethyl-2-pyridin-2-yl-1H-pyrrolo[2,3-f]benzimidazol-6-one?
5-ethyl-7,7-dimethyl-2-pyridin-2-yl-1H-pyrrolo[2,3-f]benzimidazol-6-one has a molecular weight of 306.37 g/mol, XLogP of 3.27, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-7,7-dimethyl-2-pyridin-2-yl-1H-pyrrolo[2,3-f]benzimidazol-6-one is sourced from PubChem (CID 70422686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).