About [1]benzothiepino[3,2-b]pyridine
[1]benzothiepino[3,2-b]pyridine (PubChem CID 70422995) has the molecular formula C13H9NS
and a molecular weight of 211.29 g/mol. Its IUPAC name is [1]benzothiepino[3,2-b]pyridine.
Molecular Properties
| Compound Name | [1]benzothiepino[3,2-b]pyridine |
| PubChem CID | 70422995 |
| Molecular Formula | C13H9NS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | [1]benzothiepino[3,2-b]pyridine |
| SMILES | C1=Cc2ncccc2Sc2ccccc21 |
| InChI | InChI=1S/C13H9NS/c1-2-5-12-10(4-1)7-8-11-13(15-12)6-3-9-14-11/h1-9H |
| InChIKey | PQTLYAVLEYKQHW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1]benzothiepino[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1]benzothiepino[3,2-b]pyridine?
The IUPAC name of [1]benzothiepino[3,2-b]pyridine (CID 70422995) is [1]benzothiepino[3,2-b]pyridine.
What is the SMILES notation for [1]benzothiepino[3,2-b]pyridine?
The canonical SMILES for [1]benzothiepino[3,2-b]pyridine is C1=Cc2ncccc2Sc2ccccc21.
What is the InChIKey of [1]benzothiepino[3,2-b]pyridine?
The InChIKey is PQTLYAVLEYKQHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NS/c1-2-5-12-10(4-1)7-8-11-13(15-12)6-3-9-14-11/h1-9H.
What are the key properties of [1]benzothiepino[3,2-b]pyridine?
[1]benzothiepino[3,2-b]pyridine has a molecular weight of 211.29 g/mol, XLogP of 3.72, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1]benzothiepino[3,2-b]pyridine is sourced from PubChem (CID 70422995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).