About 2,3-diethoxy-3,4-dihydro-2H-naphthalen-1-one
2,3-diethoxy-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 70423152) has the molecular formula C14H18O3
and a molecular weight of 234.29 g/mol. Its IUPAC name is 2,3-diethoxy-3,4-dihydro-2H-naphthalen-1-one.
Molecular Properties
| Compound Name | 2,3-diethoxy-3,4-dihydro-2H-naphthalen-1-one |
| PubChem CID | 70423152 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 2,3-diethoxy-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | CCOC1Cc2ccccc2C(=O)C1OCC |
| InChI | InChI=1S/C14H18O3/c1-3-16-12-9-10-7-5-6-8-11(10)13(15)14(12)17-4-2/h5-8,12,14H,3-4,9H2,1-2H3 |
| InChIKey | FOEYHSRFDFTXFA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-diethoxy-3,4-dihydro-2H-naphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diethoxy-3,4-dihydro-2H-naphthalen-1-one?
The IUPAC name of 2,3-diethoxy-3,4-dihydro-2H-naphthalen-1-one (CID 70423152) is 2,3-diethoxy-3,4-dihydro-2H-naphthalen-1-one.
What is the SMILES notation for 2,3-diethoxy-3,4-dihydro-2H-naphthalen-1-one?
The canonical SMILES for 2,3-diethoxy-3,4-dihydro-2H-naphthalen-1-one is CCOC1Cc2ccccc2C(=O)C1OCC.
What is the InChIKey of 2,3-diethoxy-3,4-dihydro-2H-naphthalen-1-one?
The InChIKey is FOEYHSRFDFTXFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O3/c1-3-16-12-9-10-7-5-6-8-11(10)13(15)14(12)17-4-2/h5-8,12,14H,3-4,9H2,1-2H3.
What are the key properties of 2,3-diethoxy-3,4-dihydro-2H-naphthalen-1-one?
2,3-diethoxy-3,4-dihydro-2H-naphthalen-1-one has a molecular weight of 234.29 g/mol, XLogP of 2.24, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diethoxy-3,4-dihydro-2H-naphthalen-1-one is sourced from PubChem (CID 70423152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).