About (4-amino-5-nitro-1-phenylcyclohexa-2,4-dien-1-yl)methanol
(4-amino-5-nitro-1-phenylcyclohexa-2,4-dien-1-yl)methanol (PubChem CID 70423174) has the molecular formula C13H14N2O3
and a molecular weight of 246.27 g/mol. Its IUPAC name is (4-amino-5-nitro-1-phenylcyclohexa-2,4-dien-1-yl)methanol.
Molecular Properties
| Compound Name | (4-amino-5-nitro-1-phenylcyclohexa-2,4-dien-1-yl)methanol |
| PubChem CID | 70423174 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | (4-amino-5-nitro-1-phenylcyclohexa-2,4-dien-1-yl)methanol |
| SMILES | NC1=C([N+](=O)[O-])CC(CO)(c2ccccc2)C=C1 |
| InChI | InChI=1S/C13H14N2O3/c14-11-6-7-13(9-16,8-12(11)15(17)18)10-4-2-1-3-5-10/h1-7,16H,8-9,14H2 |
| InChIKey | TUHHOEYUBHHQDN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-amino-5-nitro-1-phenylcyclohexa-2,4-dien-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-5-nitro-1-phenylcyclohexa-2,4-dien-1-yl)methanol?
The IUPAC name of (4-amino-5-nitro-1-phenylcyclohexa-2,4-dien-1-yl)methanol (CID 70423174) is (4-amino-5-nitro-1-phenylcyclohexa-2,4-dien-1-yl)methanol.
What is the SMILES notation for (4-amino-5-nitro-1-phenylcyclohexa-2,4-dien-1-yl)methanol?
The canonical SMILES for (4-amino-5-nitro-1-phenylcyclohexa-2,4-dien-1-yl)methanol is NC1=C([N+](=O)[O-])CC(CO)(c2ccccc2)C=C1.
What is the InChIKey of (4-amino-5-nitro-1-phenylcyclohexa-2,4-dien-1-yl)methanol?
The InChIKey is TUHHOEYUBHHQDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O3/c14-11-6-7-13(9-16,8-12(11)15(17)18)10-4-2-1-3-5-10/h1-7,16H,8-9,14H2.
What are the key properties of (4-amino-5-nitro-1-phenylcyclohexa-2,4-dien-1-yl)methanol?
(4-amino-5-nitro-1-phenylcyclohexa-2,4-dien-1-yl)methanol has a molecular weight of 246.27 g/mol, XLogP of 1.32, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-5-nitro-1-phenylcyclohexa-2,4-dien-1-yl)methanol is sourced from PubChem (CID 70423174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).