C28H47FO2Si — CID 70423611
(5R,8S,9S,10S,13R,14S,17S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-17-ethyl-4-fluoro-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 70423611) has the molecular formula C28H47FO2Si and a molecular weight of 462.77 g/mol. Its IUPAC name is (5R,8S,9S,10S,13R,14S,17S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-17-ethyl-4-fluoro-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (5R,8S,9S,10S,13R,14S,17S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-17-ethyl-4-fluoro-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70423611 |
| Molecular Formula | C28H47FO2Si |
| Molecular Weight | 462.77 g/mol |
| Exact Mass | 462.33 |
| IUPAC Name | (5R,8S,9S,10S,13R,14S,17S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-17-ethyl-4-fluoro-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C(F)C(=O)C(CO[Si](C)(C)C(C)(C)C)=C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H47FO2Si/c1-9-19-10-12-21-20-11-13-23-24(29)25(30)18(17-31-32(7,8)26(2,3)4)16-28(23,6)22(20)14-15-27(19,21)5/h16,19-24H,9-15,17H2,1-8H3/t19-,20-,21-,22-,23-,24?,27+,28+/m0/s1 |
| InChIKey | VCTJQCABOKTYEK-LMTSSULASA-N |
| XLogP | 7.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.77 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|