About 7a-ethyl-2-hydroxy-4,5-dihydro-3aH-isoindole-1,3-dione
7a-ethyl-2-hydroxy-4,5-dihydro-3aH-isoindole-1,3-dione (PubChem CID 70424130) has the molecular formula C10H13NO3
and a molecular weight of 195.21 g/mol. Its IUPAC name is 7a-ethyl-2-hydroxy-4,5-dihydro-3aH-isoindole-1,3-dione.
Molecular Properties
| Compound Name | 7a-ethyl-2-hydroxy-4,5-dihydro-3aH-isoindole-1,3-dione |
| PubChem CID | 70424130 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 7a-ethyl-2-hydroxy-4,5-dihydro-3aH-isoindole-1,3-dione |
| SMILES | CCC12C=CCCC1C(=O)N(C2=O)O |
| InChI | InChI=1S/C10H13NO3/c1-2-10-6-4-3-5-7(10)8(12)11(14)9(10)13/h4,6-7,14H,2-3,5H2,1H3 |
| InChIKey | WJDPAALUNLZWCN-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 57.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | 323 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 7a-ethyl-2-hydroxy-4,5-dihydro-3aH-isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7a-ethyl-2-hydroxy-4,5-dihydro-3aH-isoindole-1,3-dione?
The IUPAC name of 7a-ethyl-2-hydroxy-4,5-dihydro-3aH-isoindole-1,3-dione (CID 70424130) is 7a-ethyl-2-hydroxy-4,5-dihydro-3aH-isoindole-1,3-dione.
What is the SMILES notation for 7a-ethyl-2-hydroxy-4,5-dihydro-3aH-isoindole-1,3-dione?
The canonical SMILES for 7a-ethyl-2-hydroxy-4,5-dihydro-3aH-isoindole-1,3-dione is CCC12C=CCCC1C(=O)N(C2=O)O.
What is the InChIKey of 7a-ethyl-2-hydroxy-4,5-dihydro-3aH-isoindole-1,3-dione?
The InChIKey is WJDPAALUNLZWCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3/c1-2-10-6-4-3-5-7(10)8(12)11(14)9(10)13/h4,6-7,14H,2-3,5H2,1H3.
What are the key properties of 7a-ethyl-2-hydroxy-4,5-dihydro-3aH-isoindole-1,3-dione?
7a-ethyl-2-hydroxy-4,5-dihydro-3aH-isoindole-1,3-dione has a molecular weight of 195.21 g/mol, XLogP of 0.70, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7a-ethyl-2-hydroxy-4,5-dihydro-3aH-isoindole-1,3-dione is sourced from PubChem (CID 70424130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).