About ethyl(trimethyl)azanium;3-methyloxet-2-one
ethyl(trimethyl)azanium;3-methyloxet-2-one (PubChem CID 70424422) has the molecular formula C9H18NO2+
and a molecular weight of 172.25 g/mol. Its IUPAC name is ethyl(trimethyl)azanium;3-methyloxet-2-one.
Molecular Properties
| Compound Name | ethyl(trimethyl)azanium;3-methyloxet-2-one |
| PubChem CID | 70424422 |
| Molecular Formula | C9H18NO2+ |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | ethyl(trimethyl)azanium;3-methyloxet-2-one |
| SMILES | CC1=COC1=O.CC[N+](C)(C)C |
| InChI | InChI=1S/C5H14N.C4H4O2/c1-5-6(2,3)4;1-3-2-6-4(3)5/h5H2,1-4H3;2H,1H3/q+1; |
| InChIKey | NZLZGBRKVIYTSS-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl(trimethyl)azanium;3-methyloxet-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl(trimethyl)azanium;3-methyloxet-2-one?
The IUPAC name of ethyl(trimethyl)azanium;3-methyloxet-2-one (CID 70424422) is ethyl(trimethyl)azanium;3-methyloxet-2-one.
What is the SMILES notation for ethyl(trimethyl)azanium;3-methyloxet-2-one?
The canonical SMILES for ethyl(trimethyl)azanium;3-methyloxet-2-one is CC1=COC1=O.CC[N+](C)(C)C.
What is the InChIKey of ethyl(trimethyl)azanium;3-methyloxet-2-one?
The InChIKey is NZLZGBRKVIYTSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14N.C4H4O2/c1-5-6(2,3)4;1-3-2-6-4(3)5/h5H2,1-4H3;2H,1H3/q+1;.
What are the key properties of ethyl(trimethyl)azanium;3-methyloxet-2-one?
ethyl(trimethyl)azanium;3-methyloxet-2-one has a molecular weight of 172.25 g/mol, XLogP of 1.16, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl(trimethyl)azanium;3-methyloxet-2-one is sourced from PubChem (CID 70424422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).