About 3-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]propyl carbamate
3-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]propyl carbamate (PubChem CID 70424451) has the molecular formula C11H18N2O4S
and a molecular weight of 274.34 g/mol. Its IUPAC name is 3-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]propyl carbamate.
Molecular Properties
| Compound Name | 3-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]propyl carbamate |
| PubChem CID | 70424451 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 3-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]propyl carbamate |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2CC(CCCOC(N)=O)S[C@H]12 |
| InChI | InChI=1S/C11H18N2O4S/c1-6(14)8-9(15)13-5-7(18-10(8)13)3-2-4-17-11(12)16/h6-8,10,14H,2-5H2,1H3,(H2,12,16)/t6-,7?,8+,10-/m1/s1 |
| InChIKey | HUPHQRXBFVSYNI-LCFZEIEZSA-N |
| XLogP | 0.14 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]propyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]propyl carbamate?
The IUPAC name of 3-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]propyl carbamate (CID 70424451) is 3-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]propyl carbamate.
What is the SMILES notation for 3-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]propyl carbamate?
The canonical SMILES for 3-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]propyl carbamate is C[C@@H](O)[C@H]1C(=O)N2CC(CCCOC(N)=O)S[C@H]12.
What is the InChIKey of 3-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]propyl carbamate?
The InChIKey is HUPHQRXBFVSYNI-LCFZEIEZSA-N. The full InChI is InChI=1S/C11H18N2O4S/c1-6(14)8-9(15)13-5-7(18-10(8)13)3-2-4-17-11(12)16/h6-8,10,14H,2-5H2,1H3,(H2,12,16)/t6-,7?,8+,10-/m1/s1.
What are the key properties of 3-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]propyl carbamate?
3-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]propyl carbamate has a molecular weight of 274.34 g/mol, XLogP of 0.14, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]propyl carbamate is sourced from PubChem (CID 70424451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).