About 2-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]ethyl 2-aminopropanoate
2-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]ethyl 2-aminopropanoate (PubChem CID 70425109) has the molecular formula C12H20N2O4S
and a molecular weight of 288.37 g/mol. Its IUPAC name is 2-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]ethyl 2-aminopropanoate.
Molecular Properties
| Compound Name | 2-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]ethyl 2-aminopropanoate |
| PubChem CID | 70425109 |
| Molecular Formula | C12H20N2O4S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 2-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]ethyl 2-aminopropanoate |
| SMILES | CC(N)C(=O)OCCC1CN2C(=O)[C@H]([C@@H](C)O)[C@H]2S1 |
| InChI | InChI=1S/C12H20N2O4S/c1-6(13)12(17)18-4-3-8-5-14-10(16)9(7(2)15)11(14)19-8/h6-9,11,15H,3-5,13H2,1-2H3/t6?,7-,8?,9+,11-/m1/s1 |
| InChIKey | JNXUHLTWOPUIQB-HKTMFPPUSA-N |
| XLogP | -0.45 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]ethyl 2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]ethyl 2-aminopropanoate?
The IUPAC name of 2-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]ethyl 2-aminopropanoate (CID 70425109) is 2-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]ethyl 2-aminopropanoate.
What is the SMILES notation for 2-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]ethyl 2-aminopropanoate?
The canonical SMILES for 2-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]ethyl 2-aminopropanoate is CC(N)C(=O)OCCC1CN2C(=O)[C@H]([C@@H](C)O)[C@H]2S1.
What is the InChIKey of 2-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]ethyl 2-aminopropanoate?
The InChIKey is JNXUHLTWOPUIQB-HKTMFPPUSA-N. The full InChI is InChI=1S/C12H20N2O4S/c1-6(13)12(17)18-4-3-8-5-14-10(16)9(7(2)15)11(14)19-8/h6-9,11,15H,3-5,13H2,1-2H3/t6?,7-,8?,9+,11-/m1/s1.
What are the key properties of 2-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]ethyl 2-aminopropanoate?
2-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]ethyl 2-aminopropanoate has a molecular weight of 288.37 g/mol, XLogP of -0.45, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]ethyl 2-aminopropanoate is sourced from PubChem (CID 70425109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).