C9H12Cl3NS — CID 70425183
1-(trichloromethylsulfanyl)-2,3,3a,4,5,6-hexahydro-1H-isoindole (PubChem CID 70425183) has the molecular formula C9H12Cl3NS and a molecular weight of 272.63 g/mol. Its IUPAC name is 1-(trichloromethylsulfanyl)-2,3,3a,4,5,6-hexahydro-1H-isoindole.
| Compound Name | 1-(trichloromethylsulfanyl)-2,3,3a,4,5,6-hexahydro-1H-isoindole |
|---|---|
| PubChem CID | 70425183 |
| Molecular Formula | C9H12Cl3NS |
| Molecular Weight | 272.63 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | 1-(trichloromethylsulfanyl)-2,3,3a,4,5,6-hexahydro-1H-isoindole |
| SMILES | ClC(Cl)(Cl)SC1NCC2CCCC=C21 |
| InChI | InChI=1S/C9H12Cl3NS/c10-9(11,12)14-8-7-4-2-1-3-6(7)5-13-8/h4,6,8,13H,1-3,5H2 |
| InChIKey | PZIMJNBDEPVEST-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.63 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|