About 1-N,1-N,4-N,4-N-tetramethyl-2H-pyrimidine-1,4-diamine
1-N,1-N,4-N,4-N-tetramethyl-2H-pyrimidine-1,4-diamine (PubChem CID 70425452) has the molecular formula C8H16N4
and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-N,1-N,4-N,4-N-tetramethyl-2H-pyrimidine-1,4-diamine.
Analyze 1-N,1-N,4-N,4-N-tetramethyl-2H-pyrimidine-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,1-N,4-N,4-N-tetramethyl-2H-pyrimidine-1,4-diamine?
The IUPAC name of 1-N,1-N,4-N,4-N-tetramethyl-2H-pyrimidine-1,4-diamine (CID 70425452) is 1-N,1-N,4-N,4-N-tetramethyl-2H-pyrimidine-1,4-diamine.
What is the SMILES notation for 1-N,1-N,4-N,4-N-tetramethyl-2H-pyrimidine-1,4-diamine?
The canonical SMILES for 1-N,1-N,4-N,4-N-tetramethyl-2H-pyrimidine-1,4-diamine is CN(C)C1=NCN(N(C)C)C=C1.
What is the InChIKey of 1-N,1-N,4-N,4-N-tetramethyl-2H-pyrimidine-1,4-diamine?
The InChIKey is FTJAUCKVDARPSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4/c1-10(2)8-5-6-12(7-9-8)11(3)4/h5-6H,7H2,1-4H3.
What are the key properties of 1-N,1-N,4-N,4-N-tetramethyl-2H-pyrimidine-1,4-diamine?
1-N,1-N,4-N,4-N-tetramethyl-2H-pyrimidine-1,4-diamine has a molecular weight of 168.24 g/mol, XLogP of 0.21, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,1-N,4-N,4-N-tetramethyl-2H-pyrimidine-1,4-diamine is sourced from PubChem (CID 70425452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).