About 1,4-diiodobenzene;2,6-diiodonaphthalene
1,4-diiodobenzene;2,6-diiodonaphthalene (PubChem CID 70426003) has the molecular formula C16H10I4
and a molecular weight of 709.87 g/mol. Its IUPAC name is 1,4-diiodobenzene;2,6-diiodonaphthalene.
Molecular Properties
| Compound Name | 1,4-diiodobenzene;2,6-diiodonaphthalene |
| PubChem CID | 70426003 |
| Molecular Formula | C16H10I4 |
| Molecular Weight | 709.87 g/mol |
| Exact Mass | 709.70 |
| IUPAC Name | 1,4-diiodobenzene;2,6-diiodonaphthalene |
| SMILES | Ic1ccc(I)cc1.Ic1ccc2cc(I)ccc2c1 |
| InChI | InChI=1S/C10H6I2.C6H4I2/c11-9-3-1-7-5-10(12)4-2-8(7)6-9;7-5-1-2-6(8)4-3-5/h1-6H;1-4H |
| InChIKey | ILDCUNPZIAXSJU-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 709.87 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,4-diiodobenzene;2,6-diiodonaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diiodobenzene;2,6-diiodonaphthalene?
The IUPAC name of 1,4-diiodobenzene;2,6-diiodonaphthalene (CID 70426003) is 1,4-diiodobenzene;2,6-diiodonaphthalene.
What is the SMILES notation for 1,4-diiodobenzene;2,6-diiodonaphthalene?
The canonical SMILES for 1,4-diiodobenzene;2,6-diiodonaphthalene is Ic1ccc(I)cc1.Ic1ccc2cc(I)ccc2c1.
What is the InChIKey of 1,4-diiodobenzene;2,6-diiodonaphthalene?
The InChIKey is ILDCUNPZIAXSJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6I2.C6H4I2/c11-9-3-1-7-5-10(12)4-2-8(7)6-9;7-5-1-2-6(8)4-3-5/h1-6H;1-4H.
What are the key properties of 1,4-diiodobenzene;2,6-diiodonaphthalene?
1,4-diiodobenzene;2,6-diiodonaphthalene has a molecular weight of 709.87 g/mol, XLogP of 6.94, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diiodobenzene;2,6-diiodonaphthalene is sourced from PubChem (CID 70426003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).