About 2,3-dibromo-4-[3-(2,3-dibromo-4-hydroxyphenyl)-5-methyloxolan-3-yl]phenol
2,3-dibromo-4-[3-(2,3-dibromo-4-hydroxyphenyl)-5-methyloxolan-3-yl]phenol (PubChem CID 70426137) has the molecular formula C17H14Br4O3
and a molecular weight of 585.91 g/mol. Its IUPAC name is 2,3-dibromo-4-[3-(2,3-dibromo-4-hydroxyphenyl)-5-methyloxolan-3-yl]phenol.
Molecular Properties
| Compound Name | 2,3-dibromo-4-[3-(2,3-dibromo-4-hydroxyphenyl)-5-methyloxolan-3-yl]phenol |
| PubChem CID | 70426137 |
| Molecular Formula | C17H14Br4O3 |
| Molecular Weight | 585.91 g/mol |
| Exact Mass | 581.77 |
| IUPAC Name | 2,3-dibromo-4-[3-(2,3-dibromo-4-hydroxyphenyl)-5-methyloxolan-3-yl]phenol |
| SMILES | CC1CC(c2ccc(O)c(Br)c2Br)(c2ccc(O)c(Br)c2Br)CO1 |
| InChI | InChI=1S/C17H14Br4O3/c1-8-6-17(7-24-8,9-2-4-11(22)15(20)13(9)18)10-3-5-12(23)16(21)14(10)19/h2-5,8,22-23H,6-7H2,1H3 |
| InChIKey | RELRNFOCIWSRKY-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 585.91 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dibromo-4-[3-(2,3-dibromo-4-hydroxyphenyl)-5-methyloxolan-3-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dibromo-4-[3-(2,3-dibromo-4-hydroxyphenyl)-5-methyloxolan-3-yl]phenol?
The IUPAC name of 2,3-dibromo-4-[3-(2,3-dibromo-4-hydroxyphenyl)-5-methyloxolan-3-yl]phenol (CID 70426137) is 2,3-dibromo-4-[3-(2,3-dibromo-4-hydroxyphenyl)-5-methyloxolan-3-yl]phenol.
What is the SMILES notation for 2,3-dibromo-4-[3-(2,3-dibromo-4-hydroxyphenyl)-5-methyloxolan-3-yl]phenol?
The canonical SMILES for 2,3-dibromo-4-[3-(2,3-dibromo-4-hydroxyphenyl)-5-methyloxolan-3-yl]phenol is CC1CC(c2ccc(O)c(Br)c2Br)(c2ccc(O)c(Br)c2Br)CO1.
What is the InChIKey of 2,3-dibromo-4-[3-(2,3-dibromo-4-hydroxyphenyl)-5-methyloxolan-3-yl]phenol?
The InChIKey is RELRNFOCIWSRKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14Br4O3/c1-8-6-17(7-24-8,9-2-4-11(22)15(20)13(9)18)10-3-5-12(23)16(21)14(10)19/h2-5,8,22-23H,6-7H2,1H3.
What are the key properties of 2,3-dibromo-4-[3-(2,3-dibromo-4-hydroxyphenyl)-5-methyloxolan-3-yl]phenol?
2,3-dibromo-4-[3-(2,3-dibromo-4-hydroxyphenyl)-5-methyloxolan-3-yl]phenol has a molecular weight of 585.91 g/mol, XLogP of 6.24, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dibromo-4-[3-(2,3-dibromo-4-hydroxyphenyl)-5-methyloxolan-3-yl]phenol is sourced from PubChem (CID 70426137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).