About azane;ethyl 2-(dimethylamino)benzoate
azane;ethyl 2-(dimethylamino)benzoate (PubChem CID 70426390) has the molecular formula C11H18N2O2
and a molecular weight of 210.28 g/mol. Its IUPAC name is azane;ethyl 2-(dimethylamino)benzoate.
Molecular Properties
| Compound Name | azane;ethyl 2-(dimethylamino)benzoate |
| PubChem CID | 70426390 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | azane;ethyl 2-(dimethylamino)benzoate |
| SMILES | CCOC(=O)c1ccccc1N(C)C.N |
| InChI | InChI=1S/C11H15NO2.H3N/c1-4-14-11(13)9-7-5-6-8-10(9)12(2)3;/h5-8H,4H2,1-3H3;1H3 |
| InChIKey | PKSWFXVQVFSTJU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 64.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azane;ethyl 2-(dimethylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;ethyl 2-(dimethylamino)benzoate?
The IUPAC name of azane;ethyl 2-(dimethylamino)benzoate (CID 70426390) is azane;ethyl 2-(dimethylamino)benzoate.
What is the SMILES notation for azane;ethyl 2-(dimethylamino)benzoate?
The canonical SMILES for azane;ethyl 2-(dimethylamino)benzoate is CCOC(=O)c1ccccc1N(C)C.N.
What is the InChIKey of azane;ethyl 2-(dimethylamino)benzoate?
The InChIKey is PKSWFXVQVFSTJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2.H3N/c1-4-14-11(13)9-7-5-6-8-10(9)12(2)3;/h5-8H,4H2,1-3H3;1H3.
What are the key properties of azane;ethyl 2-(dimethylamino)benzoate?
azane;ethyl 2-(dimethylamino)benzoate has a molecular weight of 210.28 g/mol, XLogP of 2.09, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;ethyl 2-(dimethylamino)benzoate is sourced from PubChem (CID 70426390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).