C56H82N4O — CID 70426420
2-hexyl-5-[4-[[[4-(5-hexylpyrazin-2-yl)phenyl]-(4-pentylcyclohexyl)methoxy]-(4-pentylcyclohexyl)methyl]phenyl]pyrazine (PubChem CID 70426420) has the molecular formula C56H82N4O and a molecular weight of 827.30 g/mol. Its IUPAC name is 2-hexyl-5-[4-[[[4-(5-hexylpyrazin-2-yl)phenyl]-(4-pentylcyclohexyl)methoxy]-(4-pentylcyclohexyl)methyl]phenyl]pyrazine.
| Compound Name | 2-hexyl-5-[4-[[[4-(5-hexylpyrazin-2-yl)phenyl]-(4-pentylcyclohexyl)methoxy]-(4-pentylcyclohexyl)methyl]phenyl]pyrazine |
|---|---|
| PubChem CID | 70426420 |
| Molecular Formula | C56H82N4O |
| Molecular Weight | 827.30 g/mol |
| Exact Mass | 826.65 |
| IUPAC Name | 2-hexyl-5-[4-[[[4-(5-hexylpyrazin-2-yl)phenyl]-(4-pentylcyclohexyl)methoxy]-(4-pentylcyclohexyl)methyl]phenyl]pyrazine |
| SMILES | CCCCCCc1cnc(-c2ccc(C(OC(c3ccc(-c4cnc(CCCCCC)cn4)cc3)C3CCC(CCCCC)CC3)C3CCC(CCCCC)CC3)cc2)cn1 |
| InChI | InChI=1S/C56H82N4O/c1-5-9-13-17-21-51-39-59-53(41-57-51)45-31-35-49(36-32-45)55(47-27-23-43(24-28-47)19-15-11-7-3)61-56(48-29-25-44(26-30-48)20-16-12-8-4)50-37-33-46(34-38-50)54-42-58-52(40-60-54)22-18-14-10-6-2/h31-44,47-48,55-56H,5-30H2,1-4H3 |
| InChIKey | MJJVWWWTABBXGN-UHFFFAOYSA-N |
| XLogP | 16.42 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.30 |
| LogP ≤ 5 | 16.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|