C37H43F3N4O4 — CID 70426894
bis[3-[4-(dimethylamino)phenyl]propyl] 2,6-dimethyl-4-[2-(trifluoromethyl)-3-pyridinyl]-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70426894) has the molecular formula C37H43F3N4O4 and a molecular weight of 664.77 g/mol. Its IUPAC name is bis[3-[4-(dimethylamino)phenyl]propyl] 2,6-dimethyl-4-[2-(trifluoromethyl)-3-pyridinyl]-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | bis[3-[4-(dimethylamino)phenyl]propyl] 2,6-dimethyl-4-[2-(trifluoromethyl)-3-pyridinyl]-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70426894 |
| Molecular Formula | C37H43F3N4O4 |
| Molecular Weight | 664.77 g/mol |
| Exact Mass | 664.32 |
| IUPAC Name | bis[3-[4-(dimethylamino)phenyl]propyl] 2,6-dimethyl-4-[2-(trifluoromethyl)-3-pyridinyl]-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OCCCc2ccc(N(C)C)cc2)C(c2cccnc2C(F)(F)F)C(C(=O)OCCCc2ccc(N(C)C)cc2)=C(C)N1 |
| InChI | InChI=1S/C37H43F3N4O4/c1-24-31(35(45)47-22-8-10-26-13-17-28(18-14-26)43(3)4)33(30-12-7-21-41-34(30)37(38,39)40)32(25(2)42-24)36(46)48-23-9-11-27-15-19-29(20-16-27)44(5)6/h7,12-21,33,42H,8-11,22-23H2,1-6H3 |
| InChIKey | BBLIUTDLAONNIO-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.77 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|