C26H28F3N3O4 — CID 70426896
5-[3-[4-(dimethylamino)phenyl]propoxycarbonyl]-2,6-dimethyl-4-[2-(trifluoromethyl)-3-pyridinyl]-1,4-dihydropyridine-3-carboxylic acid (PubChem CID 70426896) has the molecular formula C26H28F3N3O4 and a molecular weight of 503.52 g/mol. Its IUPAC name is 5-[3-[4-(dimethylamino)phenyl]propoxycarbonyl]-2,6-dimethyl-4-[2-(trifluoromethyl)-3-pyridinyl]-1,4-dihydropyridine-3-carboxylic acid.
| Compound Name | 5-[3-[4-(dimethylamino)phenyl]propoxycarbonyl]-2,6-dimethyl-4-[2-(trifluoromethyl)-3-pyridinyl]-1,4-dihydropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 70426896 |
| Molecular Formula | C26H28F3N3O4 |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | 5-[3-[4-(dimethylamino)phenyl]propoxycarbonyl]-2,6-dimethyl-4-[2-(trifluoromethyl)-3-pyridinyl]-1,4-dihydropyridine-3-carboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2cccnc2C(F)(F)F)C(C(=O)OCCCc2ccc(N(C)C)cc2)=C(C)N1 |
| InChI | InChI=1S/C26H28F3N3O4/c1-15-20(24(33)34)22(19-8-5-13-30-23(19)26(27,28)29)21(16(2)31-15)25(35)36-14-6-7-17-9-11-18(12-10-17)32(3)4/h5,8-13,22,31H,6-7,14H2,1-4H3,(H,33,34) |
| InChIKey | JNNAOEXYYDAZOG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|