C27H31NO7S — CID 70426901
tert-butyl 2-[3-(3,4-diacetyloxyphenyl)prop-2-enoylamino]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 70426901) has the molecular formula C27H31NO7S and a molecular weight of 513.61 g/mol. Its IUPAC name is tert-butyl 2-[3-(3,4-diacetyloxyphenyl)prop-2-enoylamino]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | tert-butyl 2-[3-(3,4-diacetyloxyphenyl)prop-2-enoylamino]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 70426901 |
| Molecular Formula | C27H31NO7S |
| Molecular Weight | 513.61 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | tert-butyl 2-[3-(3,4-diacetyloxyphenyl)prop-2-enoylamino]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CC(=O)Oc1ccc(C=CC(=O)Nc2sc3c(c2C(=O)OC(C)(C)C)CC(C)CC3)cc1OC(C)=O |
| InChI | InChI=1S/C27H31NO7S/c1-15-7-11-22-19(13-15)24(26(32)35-27(4,5)6)25(36-22)28-23(31)12-9-18-8-10-20(33-16(2)29)21(14-18)34-17(3)30/h8-10,12,14-15H,7,11,13H2,1-6H3,(H,28,31) |
| InChIKey | ZACHZXOKABVFIH-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.61 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|