C9H10I3N3O — CID 70426906
N-(2-aminoethyl)-2,4,6-triiodobenzohydrazide (PubChem CID 70426906) has the molecular formula C9H10I3N3O and a molecular weight of 556.91 g/mol. Its IUPAC name is N-(2-aminoethyl)-2,4,6-triiodobenzohydrazide.
| Compound Name | N-(2-aminoethyl)-2,4,6-triiodobenzohydrazide |
|---|---|
| PubChem CID | 70426906 |
| Molecular Formula | C9H10I3N3O |
| Molecular Weight | 556.91 g/mol |
| Exact Mass | 556.80 |
| IUPAC Name | N-(2-aminoethyl)-2,4,6-triiodobenzohydrazide |
| SMILES | NCCN(N)C(=O)c1c(I)cc(I)cc1I |
| InChI | InChI=1S/C9H10I3N3O/c10-5-3-6(11)8(7(12)4-5)9(16)15(14)2-1-13/h3-4H,1-2,13-14H2 |
| InChIKey | LKSHKLOYUHOGRB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.91 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|