About N-(2-aminoethyl)-2,4,6-triiodobenzohydrazide
N-(2-aminoethyl)-2,4,6-triiodobenzohydrazide (PubChem CID 70426906) has the molecular formula C9H10I3N3O
and a molecular weight of 556.91 g/mol. Its IUPAC name is N-(2-aminoethyl)-2,4,6-triiodobenzohydrazide.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-2,4,6-triiodobenzohydrazide |
| PubChem CID | 70426906 |
| Molecular Formula | C9H10I3N3O |
| Molecular Weight | 556.91 g/mol |
| Exact Mass | 556.80 |
| IUPAC Name | N-(2-aminoethyl)-2,4,6-triiodobenzohydrazide |
| SMILES | NCCN(N)C(=O)c1c(I)cc(I)cc1I |
| InChI | InChI=1S/C9H10I3N3O/c10-5-3-6(11)8(7(12)4-5)9(16)15(14)2-1-13/h3-4H,1-2,13-14H2 |
| InChIKey | LKSHKLOYUHOGRB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 556.91 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminoethyl)-2,4,6-triiodobenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-2,4,6-triiodobenzohydrazide?
The IUPAC name of N-(2-aminoethyl)-2,4,6-triiodobenzohydrazide (CID 70426906) is N-(2-aminoethyl)-2,4,6-triiodobenzohydrazide.
What is the SMILES notation for N-(2-aminoethyl)-2,4,6-triiodobenzohydrazide?
The canonical SMILES for N-(2-aminoethyl)-2,4,6-triiodobenzohydrazide is NCCN(N)C(=O)c1c(I)cc(I)cc1I.
What is the InChIKey of N-(2-aminoethyl)-2,4,6-triiodobenzohydrazide?
The InChIKey is LKSHKLOYUHOGRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10I3N3O/c10-5-3-6(11)8(7(12)4-5)9(16)15(14)2-1-13/h3-4H,1-2,13-14H2.
What are the key properties of N-(2-aminoethyl)-2,4,6-triiodobenzohydrazide?
N-(2-aminoethyl)-2,4,6-triiodobenzohydrazide has a molecular weight of 556.91 g/mol, XLogP of 1.77, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-2,4,6-triiodobenzohydrazide is sourced from PubChem (CID 70426906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).