C23H32O4S — CID 70427204
(2R,3S,3aS,6aS)-5-(benzenesulfonylmethyl)-3-[(E,3S)-3-hydroxyoct-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 70427204) has the molecular formula C23H32O4S and a molecular weight of 404.57 g/mol. Its IUPAC name is (2R,3S,3aS,6aS)-5-(benzenesulfonylmethyl)-3-[(E,3S)-3-hydroxyoct-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3S,3aS,6aS)-5-(benzenesulfonylmethyl)-3-[(E,3S)-3-hydroxyoct-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 70427204 |
| Molecular Formula | C23H32O4S |
| Molecular Weight | 404.57 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | (2R,3S,3aS,6aS)-5-(benzenesulfonylmethyl)-3-[(E,3S)-3-hydroxyoct-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1[C@H]2CC(CS(=O)(=O)c3ccccc3)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C23H32O4S/c1-2-3-5-8-19(24)11-12-21-22-14-17(13-18(22)15-23(21)25)16-28(26,27)20-9-6-4-7-10-20/h4,6-7,9-13,18-19,21-25H,2-3,5,8,14-16H2,1H3/b12-11+/t18-,19-,21-,22-,23+/m0/s1 |
| InChIKey | QBPVXBRFJJXDFL-NVKCPNJFSA-N |
| XLogP | 3.90 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.57 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|