About 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]prop-2-enamide
3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]prop-2-enamide (PubChem CID 70427358) has the molecular formula C15H21NO2
and a molecular weight of 247.34 g/mol. Its IUPAC name is 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]prop-2-enamide.
Molecular Properties
| Compound Name | 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]prop-2-enamide |
| PubChem CID | 70427358 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]prop-2-enamide |
| SMILES | CC(C)c1cc(C=CC(N)=O)cc(C(C)C)c1O |
| InChI | InChI=1S/C15H21NO2/c1-9(2)12-7-11(5-6-14(16)17)8-13(10(3)4)15(12)18/h5-10,18H,1-4H3,(H2,16,17) |
| InChIKey | NQOVJDFBZYVLJQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]prop-2-enamide?
The IUPAC name of 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]prop-2-enamide (CID 70427358) is 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]prop-2-enamide.
What is the SMILES notation for 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]prop-2-enamide?
The canonical SMILES for 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]prop-2-enamide is CC(C)c1cc(C=CC(N)=O)cc(C(C)C)c1O.
What is the InChIKey of 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]prop-2-enamide?
The InChIKey is NQOVJDFBZYVLJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO2/c1-9(2)12-7-11(5-6-14(16)17)8-13(10(3)4)15(12)18/h5-10,18H,1-4H3,(H2,16,17).
What are the key properties of 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]prop-2-enamide?
3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]prop-2-enamide has a molecular weight of 247.34 g/mol, XLogP of 3.14, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]prop-2-enamide is sourced from PubChem (CID 70427358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).