C31H42O6S — CID 70427705
[(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethyl-3-(4-methylsulfinylphenyl)propanoate (PubChem CID 70427705) has the molecular formula C31H42O6S and a molecular weight of 542.74 g/mol. Its IUPAC name is [(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethyl-3-(4-methylsulfinylphenyl)propanoate.
| Compound Name | [(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethyl-3-(4-methylsulfinylphenyl)propanoate |
|---|---|
| PubChem CID | 70427705 |
| Molecular Formula | C31H42O6S |
| Molecular Weight | 542.74 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | [(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethyl-3-(4-methylsulfinylphenyl)propanoate |
| SMILES | C[C@H]1C=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](O)CC(=O)O3)[C@H]2[C@@H](OC(=O)C(C)(C)Cc2ccc(S(C)=O)cc2)C1 |
| InChI | InChI=1S/C31H42O6S/c1-19-14-22-9-6-20(2)26(13-10-24-16-23(32)17-28(33)36-24)29(22)27(15-19)37-30(34)31(3,4)18-21-7-11-25(12-8-21)38(5)35/h6-9,11-12,14,19-20,23-24,26-27,29,32H,10,13,15-18H2,1-5H3/t19-,20-,23+,24+,26-,27-,29-,38?/m0/s1 |
| InChIKey | DJYMRCVPWHTYSW-VLESLBENSA-N |
| XLogP | 5.16 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.74 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |