C13H18ClNS — CID 70427817
(4aR,10bS)-2-methyl-1,3,4,4a,5,10b-hexahydrothiochromeno[4,3-c]pyridine;hydrochloride (PubChem CID 70427817) has the molecular formula C13H18ClNS and a molecular weight of 255.81 g/mol. Its IUPAC name is (4aR,10bS)-2-methyl-1,3,4,4a,5,10b-hexahydrothiochromeno[4,3-c]pyridine;hydrochloride.
| Compound Name | (4aR,10bS)-2-methyl-1,3,4,4a,5,10b-hexahydrothiochromeno[4,3-c]pyridine;hydrochloride |
|---|---|
| PubChem CID | 70427817 |
| Molecular Formula | C13H18ClNS |
| Molecular Weight | 255.81 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | (4aR,10bS)-2-methyl-1,3,4,4a,5,10b-hexahydrothiochromeno[4,3-c]pyridine;hydrochloride |
| SMILES | CN1CC[C@H]2CSc3ccccc3[C@H]2C1.Cl |
| InChI | InChI=1S/C13H17NS.ClH/c1-14-7-6-10-9-15-13-5-3-2-4-11(13)12(10)8-14;/h2-5,10,12H,6-9H2,1H3;1H/t10-,12-;/m0./s1 |
| InChIKey | ZHWFCHSRYRYKAG-JGAZGGJJSA-N |
| XLogP | 3.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.81 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |