About 2-(3-chloro-1,2-oxazol-5-yl)propanoic acid
2-(3-chloro-1,2-oxazol-5-yl)propanoic acid (PubChem CID 70427851) has the molecular formula C6H6ClNO3
and a molecular weight of 175.57 g/mol. Its IUPAC name is 2-(3-chloro-1,2-oxazol-5-yl)propanoic acid.
Molecular Properties
| Compound Name | 2-(3-chloro-1,2-oxazol-5-yl)propanoic acid |
| PubChem CID | 70427851 |
| Molecular Formula | C6H6ClNO3 |
| Molecular Weight | 175.57 g/mol |
| Exact Mass | 175.00 |
| IUPAC Name | 2-(3-chloro-1,2-oxazol-5-yl)propanoic acid |
| SMILES | CC(C(=O)O)c1cc(Cl)no1 |
| InChI | InChI=1S/C6H6ClNO3/c1-3(6(9)10)4-2-5(7)8-11-4/h2-3H,1H3,(H,9,10) |
| InChIKey | VQVXJFWLQVBJHU-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.57 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-chloro-1,2-oxazol-5-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chloro-1,2-oxazol-5-yl)propanoic acid?
The IUPAC name of 2-(3-chloro-1,2-oxazol-5-yl)propanoic acid (CID 70427851) is 2-(3-chloro-1,2-oxazol-5-yl)propanoic acid.
What is the SMILES notation for 2-(3-chloro-1,2-oxazol-5-yl)propanoic acid?
The canonical SMILES for 2-(3-chloro-1,2-oxazol-5-yl)propanoic acid is CC(C(=O)O)c1cc(Cl)no1.
What is the InChIKey of 2-(3-chloro-1,2-oxazol-5-yl)propanoic acid?
The InChIKey is VQVXJFWLQVBJHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClNO3/c1-3(6(9)10)4-2-5(7)8-11-4/h2-3H,1H3,(H,9,10).
What are the key properties of 2-(3-chloro-1,2-oxazol-5-yl)propanoic acid?
2-(3-chloro-1,2-oxazol-5-yl)propanoic acid has a molecular weight of 175.57 g/mol, XLogP of 1.52, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chloro-1,2-oxazol-5-yl)propanoic acid is sourced from PubChem (CID 70427851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).