C37H45N5O7 — CID 70428096
ethyl 3-hydroxy-4-[[(2S)-3-(1H-imidazol-5-yl)-2-[[(2S)-3-naphthalen-1-yl-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]amino]-6-methylheptanoate (PubChem CID 70428096) has the molecular formula C37H45N5O7 and a molecular weight of 671.80 g/mol. Its IUPAC name is ethyl 3-hydroxy-4-[[(2S)-3-(1H-imidazol-5-yl)-2-[[(2S)-3-naphthalen-1-yl-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]amino]-6-methylheptanoate.
| Compound Name | ethyl 3-hydroxy-4-[[(2S)-3-(1H-imidazol-5-yl)-2-[[(2S)-3-naphthalen-1-yl-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]amino]-6-methylheptanoate |
|---|---|
| PubChem CID | 70428096 |
| Molecular Formula | C37H45N5O7 |
| Molecular Weight | 671.80 g/mol |
| Exact Mass | 671.33 |
| IUPAC Name | ethyl 3-hydroxy-4-[[(2S)-3-(1H-imidazol-5-yl)-2-[[(2S)-3-naphthalen-1-yl-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]amino]-6-methylheptanoate |
| SMILES | CCOC(=O)CC(O)C(CC(C)C)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C37H45N5O7/c1-4-48-34(44)20-33(43)30(17-24(2)3)40-36(46)32(19-28-21-38-23-39-28)41-35(45)31(42-37(47)49-22-25-11-6-5-7-12-25)18-27-15-10-14-26-13-8-9-16-29(26)27/h5-16,21,23-24,30-33,43H,4,17-20,22H2,1-3H3,(H,38,39)(H,40,46)(H,41,45)(H,42,47)/t30?,31-,32-,33?/m0/s1 |
| InChIKey | FZJCPDSUAPNCDG-DNDVYCJVSA-N |
| XLogP | 3.97 |
| TPSA | 171.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.80 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |