C39H74OSn — CID 70428277
tributyl-[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]stannane;hydrate (PubChem CID 70428277) has the molecular formula C39H74OSn and a molecular weight of 677.73 g/mol. Its IUPAC name is tributyl-[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]stannane;hydrate.
| Compound Name | tributyl-[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]stannane;hydrate |
|---|---|
| PubChem CID | 70428277 |
| Molecular Formula | C39H74OSn |
| Molecular Weight | 677.73 g/mol |
| Exact Mass | 678.48 |
| IUPAC Name | tributyl-[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]stannane;hydrate |
| SMILES | CCCC[Sn](CCCC)(CCCC)C1CC[C@@]2(C)C(=CCC3C2CC[C@@]2(C)C3CC[C@@H]2[C@H](C)CCCC(C)C)C1.O |
| InChI | InChI=1S/C27H45.3C4H9.H2O.Sn/c1-19(2)9-8-10-20(3)23-14-15-24-22-13-12-21-11-6-7-17-26(21,4)25(22)16-18-27(23,24)5;3*1-3-4-2;;/h6,12,19-20,22-25H,7-11,13-18H2,1-5H3;3*1,3-4H2,2H3;1H2;/t20-,22?,23-,24?,25?,26+,27-;;;;;/m1...../s1 |
| InChIKey | WZXSTKSDQBJHFJ-VWPHYIJZSA-N |
| XLogP | 12.42 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.73 |
| LogP ≤ 5 | 12.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|