About 4-pyridin-4-ylcyclohexane-1,2,3-trione
4-pyridin-4-ylcyclohexane-1,2,3-trione (PubChem CID 70428350) has the molecular formula C11H9NO3
and a molecular weight of 203.20 g/mol. Its IUPAC name is 4-pyridin-4-ylcyclohexane-1,2,3-trione.
Molecular Properties
| Compound Name | 4-pyridin-4-ylcyclohexane-1,2,3-trione |
| PubChem CID | 70428350 |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 4-pyridin-4-ylcyclohexane-1,2,3-trione |
| SMILES | O=C1CCC(c2ccncc2)C(=O)C1=O |
| InChI | InChI=1S/C11H9NO3/c13-9-2-1-8(10(14)11(9)15)7-3-5-12-6-4-7/h3-6,8H,1-2H2 |
| InChIKey | BCNOZYCDNLMMIH-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-pyridin-4-ylcyclohexane-1,2,3-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyridin-4-ylcyclohexane-1,2,3-trione?
The IUPAC name of 4-pyridin-4-ylcyclohexane-1,2,3-trione (CID 70428350) is 4-pyridin-4-ylcyclohexane-1,2,3-trione.
What is the SMILES notation for 4-pyridin-4-ylcyclohexane-1,2,3-trione?
The canonical SMILES for 4-pyridin-4-ylcyclohexane-1,2,3-trione is O=C1CCC(c2ccncc2)C(=O)C1=O.
What is the InChIKey of 4-pyridin-4-ylcyclohexane-1,2,3-trione?
The InChIKey is BCNOZYCDNLMMIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO3/c13-9-2-1-8(10(14)11(9)15)7-3-5-12-6-4-7/h3-6,8H,1-2H2.
What are the key properties of 4-pyridin-4-ylcyclohexane-1,2,3-trione?
4-pyridin-4-ylcyclohexane-1,2,3-trione has a molecular weight of 203.20 g/mol, XLogP of 0.67, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyridin-4-ylcyclohexane-1,2,3-trione is sourced from PubChem (CID 70428350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).