C19H34O4S — CID 70428622
sulfuric acid;tridecan-2-ylbenzene (PubChem CID 70428622) has the molecular formula C19H34O4S and a molecular weight of 358.54 g/mol. Its IUPAC name is sulfuric acid;tridecan-2-ylbenzene.
| Compound Name | sulfuric acid;tridecan-2-ylbenzene |
|---|---|
| PubChem CID | 70428622 |
| Molecular Formula | C19H34O4S |
| Molecular Weight | 358.54 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | sulfuric acid;tridecan-2-ylbenzene |
| SMILES | CCCCCCCCCCCC(C)c1ccccc1.O=S(=O)(O)O |
| InChI | InChI=1S/C19H32.H2O4S/c1-3-4-5-6-7-8-9-10-12-15-18(2)19-16-13-11-14-17-19;1-5(2,3)4/h11,13-14,16-18H,3-10,12,15H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | IPHWOJPCTMYHJJ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.54 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|