C30H56N4O2 — CID 70429171
4-cyclohexyl-N-[3-[4-[3-(4-cyclohexylbutanoylamino)propyl]piperazin-1-yl]propyl]butanamide (PubChem CID 70429171) has the molecular formula C30H56N4O2 and a molecular weight of 504.80 g/mol. Its IUPAC name is 4-cyclohexyl-N-[3-[4-[3-(4-cyclohexylbutanoylamino)propyl]piperazin-1-yl]propyl]butanamide.
| Compound Name | 4-cyclohexyl-N-[3-[4-[3-(4-cyclohexylbutanoylamino)propyl]piperazin-1-yl]propyl]butanamide |
|---|---|
| PubChem CID | 70429171 |
| Molecular Formula | C30H56N4O2 |
| Molecular Weight | 504.80 g/mol |
| Exact Mass | 504.44 |
| IUPAC Name | 4-cyclohexyl-N-[3-[4-[3-(4-cyclohexylbutanoylamino)propyl]piperazin-1-yl]propyl]butanamide |
| SMILES | O=C(CCCC1CCCCC1)NCCCN1CCN(CCCNC(=O)CCCC2CCCCC2)CC1 |
| InChI | InChI=1S/C30H56N4O2/c35-29(17-7-15-27-11-3-1-4-12-27)31-19-9-21-33-23-25-34(26-24-33)22-10-20-32-30(36)18-8-16-28-13-5-2-6-14-28/h27-28H,1-26H2,(H,31,35)(H,32,36) |
| InChIKey | XINOYCWQEPMHOO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.80 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|