C12H21N3O2 — CID 70429426
N-[1-(dimethylamino)ethyl]-5-oxo-1,2,3,6,7,8-hexahydropyrrolizine-3-carboxamide (PubChem CID 70429426) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is N-[1-(dimethylamino)ethyl]-5-oxo-1,2,3,6,7,8-hexahydropyrrolizine-3-carboxamide.
| Compound Name | N-[1-(dimethylamino)ethyl]-5-oxo-1,2,3,6,7,8-hexahydropyrrolizine-3-carboxamide |
|---|---|
| PubChem CID | 70429426 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | N-[1-(dimethylamino)ethyl]-5-oxo-1,2,3,6,7,8-hexahydropyrrolizine-3-carboxamide |
| SMILES | CC(NC(=O)C1CCC2CCC(=O)N21)N(C)C |
| InChI | InChI=1S/C12H21N3O2/c1-8(14(2)3)13-12(17)10-6-4-9-5-7-11(16)15(9)10/h8-10H,4-7H2,1-3H3,(H,13,17) |
| InChIKey | HJIDIKKXHCWAAO-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|