C29H28N4O4 — CID 70429665
8-[[3,4-bis(phenylmethoxy)phenyl]methyl]-1,3,7-trimethylpurine-2,6-dione (PubChem CID 70429665) has the molecular formula C29H28N4O4 and a molecular weight of 496.57 g/mol. Its IUPAC name is 8-[[3,4-bis(phenylmethoxy)phenyl]methyl]-1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 8-[[3,4-bis(phenylmethoxy)phenyl]methyl]-1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 70429665 |
| Molecular Formula | C29H28N4O4 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 8-[[3,4-bis(phenylmethoxy)phenyl]methyl]-1,3,7-trimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(Cc3ccc(OCc4ccccc4)c(OCc4ccccc4)c3)n2C)n(C)c1=O |
| InChI | InChI=1S/C29H28N4O4/c1-31-25(30-27-26(31)28(34)33(3)29(35)32(27)2)17-22-14-15-23(36-18-20-10-6-4-7-11-20)24(16-22)37-19-21-12-8-5-9-13-21/h4-16H,17-19H2,1-3H3 |
| InChIKey | PVFZHBSIFMQWFC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |