C31H38Cl2N2O5 — CID 70429805
1-[[4-cyano-4-(3,4-dimethoxyphenyl)-5-methylhexyl]-methylamino]propan-2-yl 3-(2,3-dichlorophenyl)-4-oxopent-2-enoate (PubChem CID 70429805) has the molecular formula C31H38Cl2N2O5 and a molecular weight of 589.56 g/mol. Its IUPAC name is 1-[[4-cyano-4-(3,4-dimethoxyphenyl)-5-methylhexyl]-methylamino]propan-2-yl 3-(2,3-dichlorophenyl)-4-oxopent-2-enoate.
| Compound Name | 1-[[4-cyano-4-(3,4-dimethoxyphenyl)-5-methylhexyl]-methylamino]propan-2-yl 3-(2,3-dichlorophenyl)-4-oxopent-2-enoate |
|---|---|
| PubChem CID | 70429805 |
| Molecular Formula | C31H38Cl2N2O5 |
| Molecular Weight | 589.56 g/mol |
| Exact Mass | 588.22 |
| IUPAC Name | 1-[[4-cyano-4-(3,4-dimethoxyphenyl)-5-methylhexyl]-methylamino]propan-2-yl 3-(2,3-dichlorophenyl)-4-oxopent-2-enoate |
| SMILES | COc1ccc(C(C#N)(CCCN(C)CC(C)OC(=O)C=C(C(C)=O)c2cccc(Cl)c2Cl)C(C)C)cc1OC |
| InChI | InChI=1S/C31H38Cl2N2O5/c1-20(2)31(19-34,23-12-13-27(38-6)28(16-23)39-7)14-9-15-35(5)18-21(3)40-29(37)17-25(22(4)36)24-10-8-11-26(32)30(24)33/h8,10-13,16-17,20-21H,9,14-15,18H2,1-7H3 |
| InChIKey | NTZKBBKOQVPETQ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 88.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.56 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|