About formic acid;3H-imidazo[4,5-c]quinoline
formic acid;3H-imidazo[4,5-c]quinoline (PubChem CID 70429853) has the molecular formula C11H9N3O2
and a molecular weight of 215.21 g/mol. Its IUPAC name is formic acid;3H-imidazo[4,5-c]quinoline.
Molecular Properties
| Compound Name | formic acid;3H-imidazo[4,5-c]quinoline |
| PubChem CID | 70429853 |
| Molecular Formula | C11H9N3O2 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | formic acid;3H-imidazo[4,5-c]quinoline |
| SMILES | O=CO.c1ccc2c(c1)ncc1[nH]cnc12 |
| InChI | InChI=1S/C10H7N3.CH2O2/c1-2-4-8-7(3-1)10-9(5-11-8)12-6-13-10;2-1-3/h1-6H,(H,12,13);1H,(H,2,3) |
| InChIKey | YKHYGUSDJXAOKZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formic acid;3H-imidazo[4,5-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;3H-imidazo[4,5-c]quinoline?
The IUPAC name of formic acid;3H-imidazo[4,5-c]quinoline (CID 70429853) is formic acid;3H-imidazo[4,5-c]quinoline.
What is the SMILES notation for formic acid;3H-imidazo[4,5-c]quinoline?
The canonical SMILES for formic acid;3H-imidazo[4,5-c]quinoline is O=CO.c1ccc2c(c1)ncc1[nH]cnc12.
What is the InChIKey of formic acid;3H-imidazo[4,5-c]quinoline?
The InChIKey is YKHYGUSDJXAOKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3.CH2O2/c1-2-4-8-7(3-1)10-9(5-11-8)12-6-13-10;2-1-3/h1-6H,(H,12,13);1H,(H,2,3).
What are the key properties of formic acid;3H-imidazo[4,5-c]quinoline?
formic acid;3H-imidazo[4,5-c]quinoline has a molecular weight of 215.21 g/mol, XLogP of 1.81, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;3H-imidazo[4,5-c]quinoline is sourced from PubChem (CID 70429853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).