C32H63FO4Si2 — CID 70430046
(Z,7R)-7-[(1S,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[1-[tert-butyl(dimethyl)silyl]oxyoctyl]cyclopentyl]-7-fluorohept-5-enoic acid (PubChem CID 70430046) has the molecular formula C32H63FO4Si2 and a molecular weight of 587.02 g/mol. Its IUPAC name is (Z,7R)-7-[(1S,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[1-[tert-butyl(dimethyl)silyl]oxyoctyl]cyclopentyl]-7-fluorohept-5-enoic acid.
| Compound Name | (Z,7R)-7-[(1S,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[1-[tert-butyl(dimethyl)silyl]oxyoctyl]cyclopentyl]-7-fluorohept-5-enoic acid |
|---|---|
| PubChem CID | 70430046 |
| Molecular Formula | C32H63FO4Si2 |
| Molecular Weight | 587.02 g/mol |
| Exact Mass | 586.42 |
| IUPAC Name | (Z,7R)-7-[(1S,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[1-[tert-butyl(dimethyl)silyl]oxyoctyl]cyclopentyl]-7-fluorohept-5-enoic acid |
| SMILES | CCCCCCCC(O[Si](C)(C)C(C)(C)C)[C@@H]1[C@@H]([C@H](F)/C=C\CCCC(=O)O)CC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H63FO4Si2/c1-12-13-14-15-18-21-27(36-38(8,9)31(2,3)4)30-25(26(33)20-17-16-19-22-29(34)35)23-24-28(30)37-39(10,11)32(5,6)7/h17,20,25-28,30H,12-16,18-19,21-24H2,1-11H3,(H,34,35)/b20-17-/t25-,26-,27?,28-,30+/m1/s1 |
| InChIKey | VFKBUFCEULHSBY-XJZSJNJTSA-N |
| XLogP | 10.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.02 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|