C19H32O4 — CID 70430115
(1'R,2'R,3'aR,6'aS)-1'-[(E)-1-hydroxy-4-methyloct-1-enyl]spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-ol (PubChem CID 70430115) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is (1'R,2'R,3'aR,6'aS)-1'-[(E)-1-hydroxy-4-methyloct-1-enyl]spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-ol.
| Compound Name | (1'R,2'R,3'aR,6'aS)-1'-[(E)-1-hydroxy-4-methyloct-1-enyl]spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-ol |
|---|---|
| PubChem CID | 70430115 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | (1'R,2'R,3'aR,6'aS)-1'-[(E)-1-hydroxy-4-methyloct-1-enyl]spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-ol |
| SMILES | CCCCC(C)C/C=C(/O)[C@@H]1[C@H]2CC3(C[C@H]2C[C@H]1O)OCCO3 |
| InChI | InChI=1S/C19H32O4/c1-3-4-5-13(2)6-7-16(20)18-15-12-19(22-8-9-23-19)11-14(15)10-17(18)21/h7,13-15,17-18,20-21H,3-6,8-12H2,1-2H3/b16-7+/t13?,14-,15+,17-,18+/m1/s1 |
| InChIKey | TWBHEINUABJIEV-YWCJGMBFSA-N |
| XLogP | 3.79 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|