About azonan-2-one;6-heptylpiperidin-2-one
azonan-2-one;6-heptylpiperidin-2-one (PubChem CID 70430159) has the molecular formula C20H38N2O2
and a molecular weight of 338.54 g/mol. Its IUPAC name is azonan-2-one;6-heptylpiperidin-2-one.
Molecular Properties
| Compound Name | azonan-2-one;6-heptylpiperidin-2-one |
| PubChem CID | 70430159 |
| Molecular Formula | C20H38N2O2 |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.29 |
| IUPAC Name | azonan-2-one;6-heptylpiperidin-2-one |
| SMILES | CCCCCCCC1CCCC(=O)N1.O=C1CCCCCCCN1 |
| InChI | InChI=1S/C12H23NO.C8H15NO/c1-2-3-4-5-6-8-11-9-7-10-12(14)13-11;10-8-6-4-2-1-3-5-7-9-8/h11H,2-10H2,1H3,(H,13,14);1-7H2,(H,9,10) |
| InChIKey | DJTIAKNSPUMXSZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze azonan-2-one;6-heptylpiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azonan-2-one;6-heptylpiperidin-2-one?
The IUPAC name of azonan-2-one;6-heptylpiperidin-2-one (CID 70430159) is azonan-2-one;6-heptylpiperidin-2-one.
What is the SMILES notation for azonan-2-one;6-heptylpiperidin-2-one?
The canonical SMILES for azonan-2-one;6-heptylpiperidin-2-one is CCCCCCCC1CCCC(=O)N1.O=C1CCCCCCCN1.
What is the InChIKey of azonan-2-one;6-heptylpiperidin-2-one?
The InChIKey is DJTIAKNSPUMXSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO.C8H15NO/c1-2-3-4-5-6-8-11-9-7-10-12(14)13-11;10-8-6-4-2-1-3-5-7-9-8/h11H,2-10H2,1H3,(H,13,14);1-7H2,(H,9,10).
What are the key properties of azonan-2-one;6-heptylpiperidin-2-one?
azonan-2-one;6-heptylpiperidin-2-one has a molecular weight of 338.54 g/mol, XLogP of 4.47, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azonan-2-one;6-heptylpiperidin-2-one is sourced from PubChem (CID 70430159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).