C21H18O5S — CID 70430303
10-oxo-1,2-bis(prop-2-enyl)-9H-thioxanthene-3,4-dicarboxylic acid (PubChem CID 70430303) has the molecular formula C21H18O5S and a molecular weight of 382.44 g/mol. Its IUPAC name is 10-oxo-1,2-bis(prop-2-enyl)-9H-thioxanthene-3,4-dicarboxylic acid.
| Compound Name | 10-oxo-1,2-bis(prop-2-enyl)-9H-thioxanthene-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 70430303 |
| Molecular Formula | C21H18O5S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 10-oxo-1,2-bis(prop-2-enyl)-9H-thioxanthene-3,4-dicarboxylic acid |
| SMILES | C=CCc1c(CC=C)c(C(=O)O)c(C(=O)O)c2c1Cc1ccccc1S2=O |
| InChI | InChI=1S/C21H18O5S/c1-3-7-13-14(8-4-2)17(20(22)23)18(21(24)25)19-15(13)11-12-9-5-6-10-16(12)27(19)26/h3-6,9-10H,1-2,7-8,11H2,(H,22,23)(H,24,25) |
| InChIKey | DVADERPNFPZEOI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|