C27H53FO4Si2 — CID 70430627
(3R,3aS,4S,5S,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-[3-[tert-butyl(dimethyl)silyl]oxyoctyl]-3-fluoro-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 70430627) has the molecular formula C27H53FO4Si2 and a molecular weight of 516.89 g/mol. Its IUPAC name is (3R,3aS,4S,5S,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-[3-[tert-butyl(dimethyl)silyl]oxyoctyl]-3-fluoro-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3R,3aS,4S,5S,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-[3-[tert-butyl(dimethyl)silyl]oxyoctyl]-3-fluoro-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 70430627 |
| Molecular Formula | C27H53FO4Si2 |
| Molecular Weight | 516.89 g/mol |
| Exact Mass | 516.35 |
| IUPAC Name | (3R,3aS,4S,5S,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-[3-[tert-butyl(dimethyl)silyl]oxyoctyl]-3-fluoro-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCCCC(CC[C@H]1[C@H]2[C@@H](C[C@@H]1O[Si](C)(C)C(C)(C)C)OC(=O)[C@@H]2F)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H53FO4Si2/c1-12-13-14-15-19(31-33(8,9)26(2,3)4)16-17-20-21(32-34(10,11)27(5,6)7)18-22-23(20)24(28)25(29)30-22/h19-24H,12-18H2,1-11H3/t19?,20-,21+,22-,23+,24-/m1/s1 |
| InChIKey | MEELUNRIAUITLR-QXSLLXTNSA-N |
| XLogP | 8.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.89 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|